Home
Products
Medicagenic acid
| Product Name | Medicagenic acid |
| Price: | $131 / 10mg |
| Catalog No.: | CN07525 |
| CAS No.: | 599-07-5 |
| Molecular Formula: | C30H46O6 |
| Molecular Weight: | 502.68 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Medicago sativa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1C[C@@]2(C)[C@H]([C@]([C@H]1O)(C)C(=O)O)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(C)(C)CC1)C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Medicagenic acid (Castanogenin) is isolated from the roots of Herniaria glabra L, exhibits potent fungistatic effects against several plant pathogens and human dermatophytes[1]. Medicagenic acid (Castanogenin) has low enzyme inhibitory activities, the target enzymes are xanthine oxidase, collagenase, elastase, tyrosinase, ChE[2]. |
| Density | 1.23g/cm3 |
| Boiling Point | 635.9ºC at 760 mmHg |
| Flash Point | 352.4ºC |
| Exact Mass | 502.32900 |
| PSA | 115.06000 |
| LogP | 5.26910 |